Anhui Fengle Agrochemical Co., Ltd.
Caring for the green life, Contributing to the golden harvest!
|
Product Details:
Payment & Shipping Terms:
|
| CAS No: | 5234-68-4 | Formula: | C12h13no2s |
|---|---|---|---|
| Appearance: | Powder | Application: | Fungicide |
| High Light: | 98%Tc Fungicide Pesticide Powder,5234-68-4 Fungicide Pesticide,Carboxin 98% Tc Fungicide Pesticide |
||
| Isomerism | None |
| Chemical formula | C12H13NO2S |
| Canonical SMILES | CC1=C(SCCO1)C(=O)NC2=CC=CC=C2 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | GYSSRZJIHXQEHQ-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C12H13NO2S/c1-9-11(16-8-7-15-9)12(14)13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14) |
General status:
| Pesticide type | Fungicide |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Systemic, inhibits mitochondrial function. Succinate Dehydrogenase Inhibitor. |
| CAS RN | 5234-68-4 |
| EC number | 226-031-1 |
| CIPAC number | 273 |
| US EPA chemical code | 090201 |
| PubChem CID | 21307 |
| Molecular mass (g mol-1) | 235.30 |
| PIN (Preferred Identification Name) | 2-methyl-N-phenyl-5,6-dihydro-1,4-oxathiine-3-carboxamide |
| IUPAC name | 5,6-dihydro-2-methyl-1,4-oxathiine-3-carboxanilide |
| CAS name | 5,6-dihydro-2-methyl-N-phenyl-1,4-oxathiin-3-carboxamide |
Contact Person: Mr. Jinlong Huang
Tel: 86-551-65326648
Fax: 86-551-65360941
